ChemNet > CAS > 219719-19-4 5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine
219719-19-4 5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine
| Ονομασία του προϊόντος |
5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine |
| Αγγλικό όνομα |
5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine;5-[(2-methylquinolin-4-yl)sulfanyl]-1,3,4-thiadiazol-2-amine |
| MF |
C12H10N4S2 |
| Μοριακό βάρος |
274.3646 |
| InChI |
InChI=1/C12H10N4S2/c1-7-6-10(17-12-16-15-11(13)18-12)8-4-2-3-5-9(8)14-7/h2-6H,1H3,(H2,13,15) |
| CAS ΟΧΙ |
219719-19-4 |
| Μοριακή δομή |
![219719-19-4 5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine](https://images-a.chemnet.com/suppliers/chembase/299/29949.gif)
|
| Πυκνότητα |
1.47g/cm3 |
| Σημείο τήξης |
205℃ |
| Σημείο βρασμού |
512.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.762 |
| Σημείο ανάφλεξης |
263.9°C |
| Πίεση ατμών |
1.25E-10mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
